About N-[(1,3-thiazol-5-ylsulfonylamino)methyl]acetamide
N-[(1,3-thiazol-5-ylsulfonylamino)methyl]acetamide (PubChem CID 140561007) has the molecular formula C6H9N3O3S2
and a molecular weight of 235.29 g/mol. Its IUPAC name is N-[(1,3-thiazol-5-ylsulfonylamino)methyl]acetamide.
Molecular Properties
| Compound Name | N-[(1,3-thiazol-5-ylsulfonylamino)methyl]acetamide |
| PubChem CID | 140561007 |
| Molecular Formula | C6H9N3O3S2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | N-[(1,3-thiazol-5-ylsulfonylamino)methyl]acetamide |
| SMILES | CC(=O)NCNS(=O)(=O)c1cncs1 |
| InChI | InChI=1S/C6H9N3O3S2/c1-5(10)8-3-9-14(11,12)6-2-7-4-13-6/h2,4,9H,3H2,1H3,(H,8,10) |
| InChIKey | ICRJMZYSTPGDPU-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,3-thiazol-5-ylsulfonylamino)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,3-thiazol-5-ylsulfonylamino)methyl]acetamide?
The IUPAC name of N-[(1,3-thiazol-5-ylsulfonylamino)methyl]acetamide (CID 140561007) is N-[(1,3-thiazol-5-ylsulfonylamino)methyl]acetamide.
What is the SMILES notation for N-[(1,3-thiazol-5-ylsulfonylamino)methyl]acetamide?
The canonical SMILES for N-[(1,3-thiazol-5-ylsulfonylamino)methyl]acetamide is CC(=O)NCNS(=O)(=O)c1cncs1.
What is the InChIKey of N-[(1,3-thiazol-5-ylsulfonylamino)methyl]acetamide?
The InChIKey is ICRJMZYSTPGDPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O3S2/c1-5(10)8-3-9-14(11,12)6-2-7-4-13-6/h2,4,9H,3H2,1H3,(H,8,10).
What are the key properties of N-[(1,3-thiazol-5-ylsulfonylamino)methyl]acetamide?
N-[(1,3-thiazol-5-ylsulfonylamino)methyl]acetamide has a molecular weight of 235.29 g/mol, XLogP of -0.49, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,3-thiazol-5-ylsulfonylamino)methyl]acetamide is sourced from PubChem (CID 140561007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).