C13H21NO3S2 — CID 140561251
3-[(3S,4S,5R)-5-hydroxy-3-methyloct-7-en-4-yl]thiophene-2-sulfonamide (PubChem CID 140561251) has the molecular formula C13H21NO3S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 3-[(3S,4S,5R)-5-hydroxy-3-methyloct-7-en-4-yl]thiophene-2-sulfonamide.
| Compound Name | 3-[(3S,4S,5R)-5-hydroxy-3-methyloct-7-en-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 140561251 |
| Molecular Formula | C13H21NO3S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 3-[(3S,4S,5R)-5-hydroxy-3-methyloct-7-en-4-yl]thiophene-2-sulfonamide |
| SMILES | C=CC[C@@H](O)[C@H](c1ccsc1S(N)(=O)=O)[C@@H](C)CC |
| InChI | InChI=1S/C13H21NO3S2/c1-4-6-11(15)12(9(3)5-2)10-7-8-18-13(10)19(14,16)17/h4,7-9,11-12,15H,1,5-6H2,2-3H3,(H2,14,16,17)/t9-,11+,12-/m0/s1 |
| InChIKey | DDSGVQBLUZSGRR-WCQGTBRESA-N |
| XLogP | 2.46 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|