C31H43ClN6O2 — CID 140561293
2-[[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-2-oxoethyl]-(2-methyl-8,9,10,11-tetrahydro-7H-azepino[1,2-b]indazol-3-yl)amino]-N-[2-(ethylamino)ethyl]acetamide;hydrochloride (PubChem CID 140561293) has the molecular formula C31H43ClN6O2 and a molecular weight of 567.18 g/mol. Its IUPAC name is 2-[[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-2-oxoethyl]-(2-methyl-8,9,10,11-tetrahydro-7H-azepino[1,2-b]indazol-3-yl)amino]-N-[2-(ethylamino)ethyl]acetamide;hydrochloride.
| Compound Name | 2-[[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-2-oxoethyl]-(2-methyl-8,9,10,11-tetrahydro-7H-azepino[1,2-b]indazol-3-yl)amino]-N-[2-(ethylamino)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 140561293 |
| Molecular Formula | C31H43ClN6O2 |
| Molecular Weight | 567.18 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | 2-[[2-[2,3-dihydro-1H-inden-2-yl(methyl)amino]-2-oxoethyl]-(2-methyl-8,9,10,11-tetrahydro-7H-azepino[1,2-b]indazol-3-yl)amino]-N-[2-(ethylamino)ethyl]acetamide;hydrochloride |
| SMILES | CCNCCNC(=O)CN(CC(=O)N(C)C1Cc2ccccc2C1)c1cc2nn3c(c2cc1C)CCCCC3.Cl |
| InChI | InChI=1S/C31H42N6O2.ClH/c1-4-32-13-14-33-30(38)20-36(21-31(39)35(3)25-17-23-10-7-8-11-24(23)18-25)29-19-27-26(16-22(29)2)28-12-6-5-9-15-37(28)34-27;/h7-8,10-11,16,19,25,32H,4-6,9,12-15,17-18,20-21H2,1-3H3,(H,33,38);1H |
| InChIKey | OIHXTZIQEGRWLY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.18 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|