C19H18N2O5S — CID 140561848
[3-cyano-2-[[(E)-3-(furan-3-yl)prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] ethyl carbonate (PubChem CID 140561848) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is [3-cyano-2-[[(E)-3-(furan-3-yl)prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] ethyl carbonate.
| Compound Name | [3-cyano-2-[[(E)-3-(furan-3-yl)prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] ethyl carbonate |
|---|---|
| PubChem CID | 140561848 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | [3-cyano-2-[[(E)-3-(furan-3-yl)prop-2-enoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1CCc2c(sc(NC(=O)/C=C/c3ccoc3)c2C#N)C1 |
| InChI | InChI=1S/C19H18N2O5S/c1-2-25-19(23)26-13-4-5-14-15(10-20)18(27-16(14)9-13)21-17(22)6-3-12-7-8-24-11-12/h3,6-8,11,13H,2,4-5,9H2,1H3,(H,21,22)/b6-3+ |
| InChIKey | KILRQZSHYYUSRR-ZZXKWVIFSA-N |
| XLogP | 3.90 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|