C11H23BO3 — CID 140562327
1-hydroxy-4,4,5,5-tetramethyl-2-propan-2-yloxyborolan-3-ol (PubChem CID 140562327) has the molecular formula C11H23BO3 and a molecular weight of 214.11 g/mol. Its IUPAC name is 1-hydroxy-4,4,5,5-tetramethyl-2-propan-2-yloxyborolan-3-ol.
| Compound Name | 1-hydroxy-4,4,5,5-tetramethyl-2-propan-2-yloxyborolan-3-ol |
|---|---|
| PubChem CID | 140562327 |
| Molecular Formula | C11H23BO3 |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-hydroxy-4,4,5,5-tetramethyl-2-propan-2-yloxyborolan-3-ol |
| SMILES | CC(C)OC1B(O)C(C)(C)C(C)(C)C1O |
| InChI | InChI=1S/C11H23BO3/c1-7(2)15-9-8(13)10(3,4)11(5,6)12(9)14/h7-9,13-14H,1-6H3 |
| InChIKey | KGOFPOUKENUJTD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|