C12H25NO4Si — CID 140564249
2-methyl-3-prop-2-enyl-N-(1-trimethoxysilylpropyl)oxiran-2-amine (PubChem CID 140564249) has the molecular formula C12H25NO4Si and a molecular weight of 275.42 g/mol. Its IUPAC name is 2-methyl-3-prop-2-enyl-N-(1-trimethoxysilylpropyl)oxiran-2-amine.
| Compound Name | 2-methyl-3-prop-2-enyl-N-(1-trimethoxysilylpropyl)oxiran-2-amine |
|---|---|
| PubChem CID | 140564249 |
| Molecular Formula | C12H25NO4Si |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2-methyl-3-prop-2-enyl-N-(1-trimethoxysilylpropyl)oxiran-2-amine |
| SMILES | C=CCC1OC1(C)NC(CC)[Si](OC)(OC)OC |
| InChI | InChI=1S/C12H25NO4Si/c1-7-9-10-12(3,17-10)13-11(8-2)18(14-4,15-5)16-6/h7,10-11,13H,1,8-9H2,2-6H3 |
| InChIKey | WINBBJYXAXLMPA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 52.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|