C16H30O2Si — CID 140564405
triethyl-[(E,1R)-1-[(2R)-2-(2-methylprop-2-enyl)oxiran-2-yl]but-2-enoxy]silane (PubChem CID 140564405) has the molecular formula C16H30O2Si and a molecular weight of 282.50 g/mol. Its IUPAC name is triethyl-[(E,1R)-1-[(2R)-2-(2-methylprop-2-enyl)oxiran-2-yl]but-2-enoxy]silane.
| Compound Name | triethyl-[(E,1R)-1-[(2R)-2-(2-methylprop-2-enyl)oxiran-2-yl]but-2-enoxy]silane |
|---|---|
| PubChem CID | 140564405 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | triethyl-[(E,1R)-1-[(2R)-2-(2-methylprop-2-enyl)oxiran-2-yl]but-2-enoxy]silane |
| SMILES | C=C(C)C[C@]1([C@@H](/C=C/C)O[Si](CC)(CC)CC)CO1 |
| InChI | InChI=1S/C16H30O2Si/c1-7-11-15(16(13-17-16)12-14(5)6)18-19(8-2,9-3)10-4/h7,11,15H,5,8-10,12-13H2,1-4,6H3/b11-7+/t15-,16-/m1/s1 |
| InChIKey | KZIYIQRGABSJLX-KNFPLBEISA-N |
| XLogP | 4.69 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|