About 3-[3-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]-1,2-benzoxazol-6-amine
3-[3-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]-1,2-benzoxazol-6-amine (PubChem CID 140564599) has the molecular formula C22H21F3N2OS
and a molecular weight of 418.48 g/mol. Its IUPAC name is 3-[3-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]-1,2-benzoxazol-6-amine.
Molecular Properties
| Compound Name | 3-[3-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]-1,2-benzoxazol-6-amine |
| PubChem CID | 140564599 |
| Molecular Formula | C22H21F3N2OS |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 3-[3-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]-1,2-benzoxazol-6-amine |
| SMILES | CC(C)c1c(CCCc2noc3cc(N)ccc23)sc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C22H21F3N2OS/c1-12(2)21-16-8-6-13(22(23,24)25)10-20(16)29-19(21)5-3-4-17-15-9-7-14(26)11-18(15)28-27-17/h6-12H,3-5,26H2,1-2H3 |
| InChIKey | YFGRTNOWVIIFEL-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]-1,2-benzoxazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]-1,2-benzoxazol-6-amine?
The IUPAC name of 3-[3-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]-1,2-benzoxazol-6-amine (CID 140564599) is 3-[3-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]-1,2-benzoxazol-6-amine.
What is the SMILES notation for 3-[3-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]-1,2-benzoxazol-6-amine?
The canonical SMILES for 3-[3-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]-1,2-benzoxazol-6-amine is CC(C)c1c(CCCc2noc3cc(N)ccc23)sc2cc(C(F)(F)F)ccc12.
What is the InChIKey of 3-[3-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]-1,2-benzoxazol-6-amine?
The InChIKey is YFGRTNOWVIIFEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21F3N2OS/c1-12(2)21-16-8-6-13(22(23,24)25)10-20(16)29-19(21)5-3-4-17-15-9-7-14(26)11-18(15)28-27-17/h6-12H,3-5,26H2,1-2H3.
What are the key properties of 3-[3-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]-1,2-benzoxazol-6-amine?
3-[3-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]-1,2-benzoxazol-6-amine has a molecular weight of 418.48 g/mol, XLogP of 6.94, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[3-propan-2-yl-6-(trifluoromethyl)-1-benzothiophen-2-yl]propyl]-1,2-benzoxazol-6-amine is sourced from PubChem (CID 140564599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).