C12H13N3O2S2 — CID 140564681
N-(1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3-thiazole-5-sulfonamide (PubChem CID 140564681) has the molecular formula C12H13N3O2S2 and a molecular weight of 295.39 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 140564681 |
| Molecular Formula | C12H13N3O2S2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | N-(1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3-thiazole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)CCNC2)c1cncs1 |
| InChI | InChI=1S/C12H13N3O2S2/c16-19(17,12-7-14-8-18-12)15-11-2-1-10-6-13-4-3-9(10)5-11/h1-2,5,7-8,13,15H,3-4,6H2 |
| InChIKey | VFRNPCSUHCKDCA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |