About N-(3,4-dimethoxyphenyl)-1,3-thiazole-5-sulfonamide
N-(3,4-dimethoxyphenyl)-1,3-thiazole-5-sulfonamide (PubChem CID 140565091) has the molecular formula C11H12N2O4S2
and a molecular weight of 300.36 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(3,4-dimethoxyphenyl)-1,3-thiazole-5-sulfonamide |
| PubChem CID | 140565091 |
| Molecular Formula | C11H12N2O4S2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-1,3-thiazole-5-sulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cncs2)cc1OC |
| InChI | InChI=1S/C11H12N2O4S2/c1-16-9-4-3-8(5-10(9)17-2)13-19(14,15)11-6-12-7-18-11/h3-7,13H,1-2H3 |
| InChIKey | SZAVWLHGSPPTCG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3,4-dimethoxyphenyl)-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethoxyphenyl)-1,3-thiazole-5-sulfonamide?
The IUPAC name of N-(3,4-dimethoxyphenyl)-1,3-thiazole-5-sulfonamide (CID 140565091) is N-(3,4-dimethoxyphenyl)-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for N-(3,4-dimethoxyphenyl)-1,3-thiazole-5-sulfonamide?
The canonical SMILES for N-(3,4-dimethoxyphenyl)-1,3-thiazole-5-sulfonamide is COc1ccc(NS(=O)(=O)c2cncs2)cc1OC.
What is the InChIKey of N-(3,4-dimethoxyphenyl)-1,3-thiazole-5-sulfonamide?
The InChIKey is SZAVWLHGSPPTCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O4S2/c1-16-9-4-3-8(5-10(9)17-2)13-19(14,15)11-6-12-7-18-11/h3-7,13H,1-2H3.
What are the key properties of N-(3,4-dimethoxyphenyl)-1,3-thiazole-5-sulfonamide?
N-(3,4-dimethoxyphenyl)-1,3-thiazole-5-sulfonamide has a molecular weight of 300.36 g/mol, XLogP of 1.96, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethoxyphenyl)-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 140565091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).