About 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(hydroxyiminomethyl)indol-1-yl]-3-fluorophenol
4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(hydroxyiminomethyl)indol-1-yl]-3-fluorophenol (PubChem CID 140566185) has the molecular formula C20H17FN4O2
and a molecular weight of 364.38 g/mol. Its IUPAC name is 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(hydroxyiminomethyl)indol-1-yl]-3-fluorophenol.
Molecular Properties
| Compound Name | 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(hydroxyiminomethyl)indol-1-yl]-3-fluorophenol |
| PubChem CID | 140566185 |
| Molecular Formula | C20H17FN4O2 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(hydroxyiminomethyl)indol-1-yl]-3-fluorophenol |
| SMILES | Cc1n[nH]c(C)c1-c1c(C=NO)c2ccccc2n1-c1ccc(O)cc1F |
| InChI | InChI=1S/C20H17FN4O2/c1-11-19(12(2)24-23-11)20-15(10-22-27)14-5-3-4-6-17(14)25(20)18-8-7-13(26)9-16(18)21/h3-10,26-27H,1-2H3,(H,23,24) |
| InChIKey | BMQVPAMYXDWFGR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 86.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(hydroxyiminomethyl)indol-1-yl]-3-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(hydroxyiminomethyl)indol-1-yl]-3-fluorophenol?
The IUPAC name of 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(hydroxyiminomethyl)indol-1-yl]-3-fluorophenol (CID 140566185) is 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(hydroxyiminomethyl)indol-1-yl]-3-fluorophenol.
What is the SMILES notation for 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(hydroxyiminomethyl)indol-1-yl]-3-fluorophenol?
The canonical SMILES for 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(hydroxyiminomethyl)indol-1-yl]-3-fluorophenol is Cc1n[nH]c(C)c1-c1c(C=NO)c2ccccc2n1-c1ccc(O)cc1F.
What is the InChIKey of 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(hydroxyiminomethyl)indol-1-yl]-3-fluorophenol?
The InChIKey is BMQVPAMYXDWFGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17FN4O2/c1-11-19(12(2)24-23-11)20-15(10-22-27)14-5-3-4-6-17(14)25(20)18-8-7-13(26)9-16(18)21/h3-10,26-27H,1-2H3,(H,23,24).
What are the key properties of 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(hydroxyiminomethyl)indol-1-yl]-3-fluorophenol?
4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(hydroxyiminomethyl)indol-1-yl]-3-fluorophenol has a molecular weight of 364.38 g/mol, XLogP of 4.29, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)-3-(hydroxyiminomethyl)indol-1-yl]-3-fluorophenol is sourced from PubChem (CID 140566185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).