C12H16FNO — CID 140566210
(3R,4R)-1-benzyl-3-fluoro-4-methoxypyrrolidine (PubChem CID 140566210) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-3-fluoro-4-methoxypyrrolidine.
| Compound Name | (3R,4R)-1-benzyl-3-fluoro-4-methoxypyrrolidine |
|---|---|
| PubChem CID | 140566210 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (3R,4R)-1-benzyl-3-fluoro-4-methoxypyrrolidine |
| SMILES | CO[C@@H]1CN(Cc2ccccc2)C[C@H]1F |
| InChI | InChI=1S/C12H16FNO/c1-15-12-9-14(8-11(12)13)7-10-5-3-2-4-6-10/h2-6,11-12H,7-9H2,1H3/t11-,12-/m1/s1 |
| InChIKey | DVGWQTHDWFKEER-VXGBXAGGSA-N |
| XLogP | 1.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |