About N-(4-formyl-1,4-diazepan-1-yl)acetamide
N-(4-formyl-1,4-diazepan-1-yl)acetamide (PubChem CID 140566843) has the molecular formula C8H15N3O2
and a molecular weight of 185.23 g/mol. Its IUPAC name is N-(4-formyl-1,4-diazepan-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-formyl-1,4-diazepan-1-yl)acetamide |
| PubChem CID | 140566843 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N-(4-formyl-1,4-diazepan-1-yl)acetamide |
| SMILES | CC(=O)NN1CCCN(C=O)CC1 |
| InChI | InChI=1S/C8H15N3O2/c1-8(13)9-11-4-2-3-10(7-12)5-6-11/h7H,2-6H2,1H3,(H,9,13) |
| InChIKey | PGBVYKAAMWNPPQ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(4-formyl-1,4-diazepan-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-formyl-1,4-diazepan-1-yl)acetamide?
The IUPAC name of N-(4-formyl-1,4-diazepan-1-yl)acetamide (CID 140566843) is N-(4-formyl-1,4-diazepan-1-yl)acetamide.
What is the SMILES notation for N-(4-formyl-1,4-diazepan-1-yl)acetamide?
The canonical SMILES for N-(4-formyl-1,4-diazepan-1-yl)acetamide is CC(=O)NN1CCCN(C=O)CC1.
What is the InChIKey of N-(4-formyl-1,4-diazepan-1-yl)acetamide?
The InChIKey is PGBVYKAAMWNPPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O2/c1-8(13)9-11-4-2-3-10(7-12)5-6-11/h7H,2-6H2,1H3,(H,9,13).
What are the key properties of N-(4-formyl-1,4-diazepan-1-yl)acetamide?
N-(4-formyl-1,4-diazepan-1-yl)acetamide has a molecular weight of 185.23 g/mol, XLogP of -0.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-formyl-1,4-diazepan-1-yl)acetamide is sourced from PubChem (CID 140566843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).