C26H29ClN4O4S — CID 140567070
2-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-3-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)benzamide (PubChem CID 140567070) has the molecular formula C26H29ClN4O4S and a molecular weight of 529.06 g/mol. Its IUPAC name is 2-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-3-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)benzamide.
| Compound Name | 2-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-3-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)benzamide |
|---|---|
| PubChem CID | 140567070 |
| Molecular Formula | C26H29ClN4O4S |
| Molecular Weight | 529.06 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 2-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-3-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)benzamide |
| SMILES | NC(=O)c1cccc(C2=CSC3=NCCN23)c1[C@@H](C(=O)N1C[C@H](Cl)[C@H]2OCC(=O)[C@H]21)C1CCCCC1 |
| InChI | InChI=1S/C26H29ClN4O4S/c27-17-11-31(22-19(32)12-35-23(17)22)25(34)20(14-5-2-1-3-6-14)21-15(7-4-8-16(21)24(28)33)18-13-36-26-29-9-10-30(18)26/h4,7-8,13-14,17,20,22-23H,1-3,5-6,9-12H2,(H2,28,33)/t17-,20-,22+,23+/m0/s1 |
| InChIKey | CSYLJZXVJOKDIG-CZEIZJIKSA-N |
| XLogP | 2.95 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.06 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|