About 1,3-thiazol-5-ylmethyl N-[2-[1-[5-(4-cyanophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate
1,3-thiazol-5-ylmethyl N-[2-[1-[5-(4-cyanophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate (PubChem CID 140567344) has the molecular formula C24H25N5O2S
and a molecular weight of 447.56 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[2-[1-[5-(4-cyanophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate.
Molecular Properties
| Compound Name | 1,3-thiazol-5-ylmethyl N-[2-[1-[5-(4-cyanophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate |
| PubChem CID | 140567344 |
| Molecular Formula | C24H25N5O2S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[2-[1-[5-(4-cyanophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate |
| SMILES | N#Cc1ccc(-c2ccc(N3CCC(CCNC(=O)OCc4cncs4)CC3)nc2)cc1 |
| InChI | InChI=1S/C24H25N5O2S/c25-13-19-1-3-20(4-2-19)21-5-6-23(28-14-21)29-11-8-18(9-12-29)7-10-27-24(30)31-16-22-15-26-17-32-22/h1-6,14-15,17-18H,7-12,16H2,(H,27,30) |
| InChIKey | UUPCSCPYZPHDAM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,3-thiazol-5-ylmethyl N-[2-[1-[5-(4-cyanophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-thiazol-5-ylmethyl N-[2-[1-[5-(4-cyanophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate?
The IUPAC name of 1,3-thiazol-5-ylmethyl N-[2-[1-[5-(4-cyanophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate (CID 140567344) is 1,3-thiazol-5-ylmethyl N-[2-[1-[5-(4-cyanophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate.
What is the SMILES notation for 1,3-thiazol-5-ylmethyl N-[2-[1-[5-(4-cyanophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate?
The canonical SMILES for 1,3-thiazol-5-ylmethyl N-[2-[1-[5-(4-cyanophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate is N#Cc1ccc(-c2ccc(N3CCC(CCNC(=O)OCc4cncs4)CC3)nc2)cc1.
What is the InChIKey of 1,3-thiazol-5-ylmethyl N-[2-[1-[5-(4-cyanophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate?
The InChIKey is UUPCSCPYZPHDAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25N5O2S/c25-13-19-1-3-20(4-2-19)21-5-6-23(28-14-21)29-11-8-18(9-12-29)7-10-27-24(30)31-16-22-15-26-17-32-22/h1-6,14-15,17-18H,7-12,16H2,(H,27,30).
What are the key properties of 1,3-thiazol-5-ylmethyl N-[2-[1-[5-(4-cyanophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate?
1,3-thiazol-5-ylmethyl N-[2-[1-[5-(4-cyanophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate has a molecular weight of 447.56 g/mol, XLogP of 4.61, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-thiazol-5-ylmethyl N-[2-[1-[5-(4-cyanophenyl)-2-pyridinyl]piperidin-4-yl]ethyl]carbamate is sourced from PubChem (CID 140567344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).