About 6-amino-5-fluoro-4-hydroxy-3-methyl-4,5-dihydropyrimidin-2-one
6-amino-5-fluoro-4-hydroxy-3-methyl-4,5-dihydropyrimidin-2-one (PubChem CID 14056737) has the molecular formula C5H8FN3O2
and a molecular weight of 161.14 g/mol. Its IUPAC name is 6-amino-5-fluoro-4-hydroxy-3-methyl-4,5-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | 6-amino-5-fluoro-4-hydroxy-3-methyl-4,5-dihydropyrimidin-2-one |
| PubChem CID | 14056737 |
| Molecular Formula | C5H8FN3O2 |
| Molecular Weight | 161.14 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 6-amino-5-fluoro-4-hydroxy-3-methyl-4,5-dihydropyrimidin-2-one |
| SMILES | CN1C(=O)N=C(N)C(F)C1O |
| InChI | InChI=1S/C5H8FN3O2/c1-9-4(10)2(6)3(7)8-5(9)11/h2,4,10H,1H3,(H2,7,8,11) |
| InChIKey | GFTUZOVINMHQDL-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.14 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-5-fluoro-4-hydroxy-3-methyl-4,5-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-fluoro-4-hydroxy-3-methyl-4,5-dihydropyrimidin-2-one?
The IUPAC name of 6-amino-5-fluoro-4-hydroxy-3-methyl-4,5-dihydropyrimidin-2-one (CID 14056737) is 6-amino-5-fluoro-4-hydroxy-3-methyl-4,5-dihydropyrimidin-2-one.
What is the SMILES notation for 6-amino-5-fluoro-4-hydroxy-3-methyl-4,5-dihydropyrimidin-2-one?
The canonical SMILES for 6-amino-5-fluoro-4-hydroxy-3-methyl-4,5-dihydropyrimidin-2-one is CN1C(=O)N=C(N)C(F)C1O.
What is the InChIKey of 6-amino-5-fluoro-4-hydroxy-3-methyl-4,5-dihydropyrimidin-2-one?
The InChIKey is GFTUZOVINMHQDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FN3O2/c1-9-4(10)2(6)3(7)8-5(9)11/h2,4,10H,1H3,(H2,7,8,11).
What are the key properties of 6-amino-5-fluoro-4-hydroxy-3-methyl-4,5-dihydropyrimidin-2-one?
6-amino-5-fluoro-4-hydroxy-3-methyl-4,5-dihydropyrimidin-2-one has a molecular weight of 161.14 g/mol, XLogP of -0.93, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-fluoro-4-hydroxy-3-methyl-4,5-dihydropyrimidin-2-one is sourced from PubChem (CID 14056737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).