C21H27N3O9 — CID 140568539
1-[3,5-bis(1-but-3-enoyloxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl but-3-enoate (PubChem CID 140568539) has the molecular formula C21H27N3O9 and a molecular weight of 465.46 g/mol. Its IUPAC name is 1-[3,5-bis(1-but-3-enoyloxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl but-3-enoate.
| Compound Name | 1-[3,5-bis(1-but-3-enoyloxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl but-3-enoate |
|---|---|
| PubChem CID | 140568539 |
| Molecular Formula | C21H27N3O9 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 1-[3,5-bis(1-but-3-enoyloxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl but-3-enoate |
| SMILES | C=CCC(=O)OC(C)n1c(=O)n(C(C)OC(=O)CC=C)c(=O)n(C(C)OC(=O)CC=C)c1=O |
| InChI | InChI=1S/C21H27N3O9/c1-7-10-16(25)31-13(4)22-19(28)23(14(5)32-17(26)11-8-2)21(30)24(20(22)29)15(6)33-18(27)12-9-3/h7-9,13-15H,1-3,10-12H2,4-6H3 |
| InChIKey | DVKAOVYGLHJEFZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|