C28H57NSi2 — CID 140568847
2-[[(E)-but-2-enyl]-dipropylsilyl]-N-[6-[[(E)-but-2-enyl]-dipropylsilyl]hexyl]ethanimine (PubChem CID 140568847) has the molecular formula C28H57NSi2 and a molecular weight of 463.94 g/mol. Its IUPAC name is 2-[[(E)-but-2-enyl]-dipropylsilyl]-N-[6-[[(E)-but-2-enyl]-dipropylsilyl]hexyl]ethanimine.
| Compound Name | 2-[[(E)-but-2-enyl]-dipropylsilyl]-N-[6-[[(E)-but-2-enyl]-dipropylsilyl]hexyl]ethanimine |
|---|---|
| PubChem CID | 140568847 |
| Molecular Formula | C28H57NSi2 |
| Molecular Weight | 463.94 g/mol |
| Exact Mass | 463.40 |
| IUPAC Name | 2-[[(E)-but-2-enyl]-dipropylsilyl]-N-[6-[[(E)-but-2-enyl]-dipropylsilyl]hexyl]ethanimine |
| SMILES | C/C=C/C[Si](C/C=N/CCCCCC[Si](C/C=C/C)(CCC)CCC)(CCC)CCC |
| InChI | InChI=1S/C28H57NSi2/c1-7-13-25-30(21-9-3,22-10-4)27-18-16-15-17-19-29-20-28-31(23-11-5,24-12-6)26-14-8-2/h7-8,13-14,20H,9-12,15-19,21-28H2,1-6H3/b13-7+,14-8+,29-20+ |
| InChIKey | LJTZEEKESNWRCT-SMCHKILHSA-N |
| XLogP | 10.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.94 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|