About (2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-ol
(2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-ol (PubChem CID 14056887) has the molecular formula C12H24O3Si
and a molecular weight of 244.41 g/mol. Its IUPAC name is (2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-ol.
Molecular Properties
| Compound Name | (2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-ol |
| PubChem CID | 14056887 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C[C@H](O)C=CO1 |
| InChI | InChI=1S/C12H24O3Si/c1-12(2,3)16(4,5)15-9-11-8-10(13)6-7-14-11/h6-7,10-11,13H,8-9H2,1-5H3/t10-,11+/m1/s1 |
| InChIKey | MUUDBSYNDNJVAT-MNOVXSKESA-N |
| XLogP | 2.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-ol?
The IUPAC name of (2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-ol (CID 14056887) is (2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-ol.
What is the SMILES notation for (2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-ol?
The canonical SMILES for (2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-ol is CC(C)(C)[Si](C)(C)OC[C@@H]1C[C@H](O)C=CO1.
What is the InChIKey of (2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-ol?
The InChIKey is MUUDBSYNDNJVAT-MNOVXSKESA-N. The full InChI is InChI=1S/C12H24O3Si/c1-12(2,3)16(4,5)15-9-11-8-10(13)6-7-14-11/h6-7,10-11,13H,8-9H2,1-5H3/t10-,11+/m1/s1.
What are the key properties of (2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-ol?
(2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-ol has a molecular weight of 244.41 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-4-ol is sourced from PubChem (CID 14056887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).