C18H35NSi — CID 140568873
[1-(2,3,4,5,6,7-hexahydroazocin-8-yl)-2-methylprop-2-enyl]-methyl-dipropylsilane (PubChem CID 140568873) has the molecular formula C18H35NSi and a molecular weight of 293.57 g/mol. Its IUPAC name is [1-(2,3,4,5,6,7-hexahydroazocin-8-yl)-2-methylprop-2-enyl]-methyl-dipropylsilane.
| Compound Name | [1-(2,3,4,5,6,7-hexahydroazocin-8-yl)-2-methylprop-2-enyl]-methyl-dipropylsilane |
|---|---|
| PubChem CID | 140568873 |
| Molecular Formula | C18H35NSi |
| Molecular Weight | 293.57 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | [1-(2,3,4,5,6,7-hexahydroazocin-8-yl)-2-methylprop-2-enyl]-methyl-dipropylsilane |
| SMILES | C=C(C)C(/C1=N/CCCCCC1)[Si](C)(CCC)CCC |
| InChI | InChI=1S/C18H35NSi/c1-6-14-20(5,15-7-2)18(16(3)4)17-12-10-8-9-11-13-19-17/h18H,3,6-15H2,1-2,4-5H3/b19-17+ |
| InChIKey | FMHZYSLEIOYMGB-HTXNQAPBSA-N |
| XLogP | 6.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.57 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|