C20H39NSi — CID 140568893
methyl-[2-methyl-1-(2,3,4,5,6,7,8,9-octahydroazecin-10-yl)prop-2-enyl]-dipropylsilane (PubChem CID 140568893) has the molecular formula C20H39NSi and a molecular weight of 321.63 g/mol. Its IUPAC name is methyl-[2-methyl-1-(2,3,4,5,6,7,8,9-octahydroazecin-10-yl)prop-2-enyl]-dipropylsilane.
| Compound Name | methyl-[2-methyl-1-(2,3,4,5,6,7,8,9-octahydroazecin-10-yl)prop-2-enyl]-dipropylsilane |
|---|---|
| PubChem CID | 140568893 |
| Molecular Formula | C20H39NSi |
| Molecular Weight | 321.63 g/mol |
| Exact Mass | 321.29 |
| IUPAC Name | methyl-[2-methyl-1-(2,3,4,5,6,7,8,9-octahydroazecin-10-yl)prop-2-enyl]-dipropylsilane |
| SMILES | C=C(C)C(/C1=N/CCCCCCCC1)[Si](C)(CCC)CCC |
| InChI | InChI=1S/C20H39NSi/c1-6-16-22(5,17-7-2)20(18(3)4)19-14-12-10-8-9-11-13-15-21-19/h20H,3,6-17H2,1-2,4-5H3/b21-19+ |
| InChIKey | BBPZCJLNJCTFOF-XUTLUUPISA-N |
| XLogP | 7.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.63 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|