C20H41NSi2 — CID 140568965
3-[dimethyl(prop-1-en-2-yl)silyl]-N-[7-[dimethyl(prop-1-en-2-yl)silyl]heptyl]propan-1-imine (PubChem CID 140568965) has the molecular formula C20H41NSi2 and a molecular weight of 351.73 g/mol. Its IUPAC name is 3-[dimethyl(prop-1-en-2-yl)silyl]-N-[7-[dimethyl(prop-1-en-2-yl)silyl]heptyl]propan-1-imine.
| Compound Name | 3-[dimethyl(prop-1-en-2-yl)silyl]-N-[7-[dimethyl(prop-1-en-2-yl)silyl]heptyl]propan-1-imine |
|---|---|
| PubChem CID | 140568965 |
| Molecular Formula | C20H41NSi2 |
| Molecular Weight | 351.73 g/mol |
| Exact Mass | 351.28 |
| IUPAC Name | 3-[dimethyl(prop-1-en-2-yl)silyl]-N-[7-[dimethyl(prop-1-en-2-yl)silyl]heptyl]propan-1-imine |
| SMILES | C=C(C)[Si](C)(C)CC/C=N/CCCCCCC[Si](C)(C)C(=C)C |
| InChI | InChI=1S/C20H41NSi2/c1-19(2)22(5,6)17-13-11-9-10-12-15-21-16-14-18-23(7,8)20(3)4/h16H,1,3,9-15,17-18H2,2,4-8H3/b21-16+ |
| InChIKey | CMQCLPPBJKOMPL-LTGZKZEYSA-N |
| XLogP | 7.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.73 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|