C7H10N4O — CID 140569719
1,2,3,5-tetrahydroimidazo[1,2-a]pyrazine-2-carboxamide (PubChem CID 140569719) has the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. Its IUPAC name is 1,2,3,5-tetrahydroimidazo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | 1,2,3,5-tetrahydroimidazo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 140569719 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 1,2,3,5-tetrahydroimidazo[1,2-a]pyrazine-2-carboxamide |
| SMILES | NC(=O)C1CN2CC=NC=C2N1 |
| InChI | InChI=1S/C7H10N4O/c8-7(12)5-4-11-2-1-9-3-6(11)10-5/h1,3,5,10H,2,4H2,(H2,8,12) |
| InChIKey | HUNRMRIQZMYBJX-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |