C11H15F5N2O2S — CID 140569939
2-(1,1,2,2,3-pentafluorobutylsulfonyl)-2-piperidin-4-ylacetonitrile (PubChem CID 140569939) has the molecular formula C11H15F5N2O2S and a molecular weight of 334.31 g/mol. Its IUPAC name is 2-(1,1,2,2,3-pentafluorobutylsulfonyl)-2-piperidin-4-ylacetonitrile.
| Compound Name | 2-(1,1,2,2,3-pentafluorobutylsulfonyl)-2-piperidin-4-ylacetonitrile |
|---|---|
| PubChem CID | 140569939 |
| Molecular Formula | C11H15F5N2O2S |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 2-(1,1,2,2,3-pentafluorobutylsulfonyl)-2-piperidin-4-ylacetonitrile |
| SMILES | CC(F)C(F)(F)C(F)(F)S(=O)(=O)C(C#N)C1CCNCC1 |
| InChI | InChI=1S/C11H15F5N2O2S/c1-7(12)10(13,14)11(15,16)21(19,20)9(6-17)8-2-4-18-5-3-8/h7-9,18H,2-5H2,1H3 |
| InChIKey | CWGNZXTWXGYORY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|