C23H21FN4O2S — CID 140570137
4-[(2S)-2-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propyl]-5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-amine (PubChem CID 140570137) has the molecular formula C23H21FN4O2S and a molecular weight of 436.51 g/mol. Its IUPAC name is 4-[(2S)-2-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propyl]-5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-[(2S)-2-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propyl]-5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 140570137 |
| Molecular Formula | C23H21FN4O2S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 4-[(2S)-2-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propyl]-5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(C[C@@H](N)Cc2ccc3c(c2)OCCO3)c(-c2ccc3cnc(F)cc3c2)s1 |
| InChI | InChI=1S/C23H21FN4O2S/c24-21-10-16-9-14(2-3-15(16)12-27-21)22-18(28-23(26)31-22)11-17(25)7-13-1-4-19-20(8-13)30-6-5-29-19/h1-4,8-10,12,17H,5-7,11,25H2,(H2,26,28)/t17-/m0/s1 |
| InChIKey | DDTXXKUYSYDVPN-KRWDZBQOSA-N |
| XLogP | 3.96 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|