C30H33ClF3N3O5S — CID 140570369
(2,2,2-trifluoroacetyl) 4-[4-[3-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-thiadiazol-3-yl]-2-ethylphenyl]piperidin-1-yl]butaneperoxoate (PubChem CID 140570369) has the molecular formula C30H33ClF3N3O5S and a molecular weight of 640.12 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-[4-[3-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-thiadiazol-3-yl]-2-ethylphenyl]piperidin-1-yl]butaneperoxoate.
| Compound Name | (2,2,2-trifluoroacetyl) 4-[4-[3-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-thiadiazol-3-yl]-2-ethylphenyl]piperidin-1-yl]butaneperoxoate |
|---|---|
| PubChem CID | 140570369 |
| Molecular Formula | C30H33ClF3N3O5S |
| Molecular Weight | 640.12 g/mol |
| Exact Mass | 639.18 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-[4-[3-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-thiadiazol-3-yl]-2-ethylphenyl]piperidin-1-yl]butaneperoxoate |
| SMILES | CCc1c(-c2nsc(-c3ccc(OC(C)C)c(Cl)c3)n2)cccc1C1CCN(CCCC(=O)OOC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C30H33ClF3N3O5S/c1-4-21-22(19-12-15-37(16-13-19)14-6-9-26(38)41-42-29(39)30(32,33)34)7-5-8-23(21)27-35-28(43-36-27)20-10-11-25(24(31)17-20)40-18(2)3/h5,7-8,10-11,17-19H,4,6,9,12-16H2,1-3H3 |
| InChIKey | WRNMOZMCDUANLH-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.12 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|