About sodium hex-2-ene-1-sulfonate
sodium hex-2-ene-1-sulfonate (PubChem CID 140570669) has the molecular formula C6H11NaO3S
and a molecular weight of 186.21 g/mol. Its IUPAC name is sodium hex-2-ene-1-sulfonate.
Molecular Properties
| Compound Name | sodium hex-2-ene-1-sulfonate |
| PubChem CID | 140570669 |
| Molecular Formula | C6H11NaO3S |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | sodium hex-2-ene-1-sulfonate |
| SMILES | CCCC=CCS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H12O3S.Na/c1-2-3-4-5-6-10(7,8)9;/h4-5H,2-3,6H2,1H3,(H,7,8,9);/q;+1/p-1 |
| InChIKey | SPSBIKQWSJKWIG-UHFFFAOYSA-M |
| XLogP | -2.11 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium hex-2-ene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium hex-2-ene-1-sulfonate?
The IUPAC name of sodium hex-2-ene-1-sulfonate (CID 140570669) is sodium hex-2-ene-1-sulfonate.
What is the SMILES notation for sodium hex-2-ene-1-sulfonate?
The canonical SMILES for sodium hex-2-ene-1-sulfonate is CCCC=CCS(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium hex-2-ene-1-sulfonate?
The InChIKey is SPSBIKQWSJKWIG-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12O3S.Na/c1-2-3-4-5-6-10(7,8)9;/h4-5H,2-3,6H2,1H3,(H,7,8,9);/q;+1/p-1.
What are the key properties of sodium hex-2-ene-1-sulfonate?
sodium hex-2-ene-1-sulfonate has a molecular weight of 186.21 g/mol, XLogP of -2.11, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium hex-2-ene-1-sulfonate is sourced from PubChem (CID 140570669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).