C15H24O3 — CID 140571192
ethyl (E)-3-[(6S)-6-(hydroxymethyl)-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl]prop-2-enoate (PubChem CID 140571192) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is ethyl (E)-3-[(6S)-6-(hydroxymethyl)-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(6S)-6-(hydroxymethyl)-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl]prop-2-enoate |
|---|---|
| PubChem CID | 140571192 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | ethyl (E)-3-[(6S)-6-(hydroxymethyl)-4,5,5-trimethyl-1-bicyclo[2.1.1]hexanyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C12CCC(C)([C@@H]1CO)C2(C)C |
| InChI | InChI=1S/C15H24O3/c1-5-18-12(17)6-7-15-9-8-14(4,11(15)10-16)13(15,2)3/h6-7,11,16H,5,8-10H2,1-4H3/b7-6+/t11-,14?,15?/m0/s1 |
| InChIKey | PIEOWGDYGOYUJY-VYGBASKVSA-N |
| XLogP | 2.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|