C23H25FN6O2 — CID 140572074
2-N-[4-(3-fluoro-2-methylpiperidin-1-yl)phenyl]-3-nitro-6-N-(pyridin-4-ylmethyl)pyridine-2,6-diamine (PubChem CID 140572074) has the molecular formula C23H25FN6O2 and a molecular weight of 436.49 g/mol. Its IUPAC name is 2-N-[4-(3-fluoro-2-methylpiperidin-1-yl)phenyl]-3-nitro-6-N-(pyridin-4-ylmethyl)pyridine-2,6-diamine.
| Compound Name | 2-N-[4-(3-fluoro-2-methylpiperidin-1-yl)phenyl]-3-nitro-6-N-(pyridin-4-ylmethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 140572074 |
| Molecular Formula | C23H25FN6O2 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-N-[4-(3-fluoro-2-methylpiperidin-1-yl)phenyl]-3-nitro-6-N-(pyridin-4-ylmethyl)pyridine-2,6-diamine |
| SMILES | CC1C(F)CCCN1c1ccc(Nc2nc(NCc3ccncc3)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H25FN6O2/c1-16-20(24)3-2-14-29(16)19-6-4-18(5-7-19)27-23-21(30(31)32)8-9-22(28-23)26-15-17-10-12-25-13-11-17/h4-13,16,20H,2-3,14-15H2,1H3,(H2,26,27,28) |
| InChIKey | QZZMSNWWAMRBBC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|