C22H24FN7O2 — CID 140572113
2-N-[4-(4-amino-3-fluoropiperidin-1-yl)phenyl]-3-nitro-6-N-(pyridin-3-ylmethyl)pyridine-2,6-diamine (PubChem CID 140572113) has the molecular formula C22H24FN7O2 and a molecular weight of 437.48 g/mol. Its IUPAC name is 2-N-[4-(4-amino-3-fluoropiperidin-1-yl)phenyl]-3-nitro-6-N-(pyridin-3-ylmethyl)pyridine-2,6-diamine.
| Compound Name | 2-N-[4-(4-amino-3-fluoropiperidin-1-yl)phenyl]-3-nitro-6-N-(pyridin-3-ylmethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 140572113 |
| Molecular Formula | C22H24FN7O2 |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 2-N-[4-(4-amino-3-fluoropiperidin-1-yl)phenyl]-3-nitro-6-N-(pyridin-3-ylmethyl)pyridine-2,6-diamine |
| SMILES | NC1CCN(c2ccc(Nc3nc(NCc4cccnc4)ccc3[N+](=O)[O-])cc2)CC1F |
| InChI | InChI=1S/C22H24FN7O2/c23-18-14-29(11-9-19(18)24)17-5-3-16(4-6-17)27-22-20(30(31)32)7-8-21(28-22)26-13-15-2-1-10-25-12-15/h1-8,10,12,18-19H,9,11,13-14,24H2,(H2,26,27,28) |
| InChIKey | CDYYUCSTIJPOKB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|