C22H23FN6O2 — CID 140572173
2-N-[4-(3-fluoropiperidin-1-yl)phenyl]-3-nitro-6-N-(pyridin-3-ylmethyl)pyridine-2,6-diamine (PubChem CID 140572173) has the molecular formula C22H23FN6O2 and a molecular weight of 422.46 g/mol. Its IUPAC name is 2-N-[4-(3-fluoropiperidin-1-yl)phenyl]-3-nitro-6-N-(pyridin-3-ylmethyl)pyridine-2,6-diamine.
| Compound Name | 2-N-[4-(3-fluoropiperidin-1-yl)phenyl]-3-nitro-6-N-(pyridin-3-ylmethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 140572173 |
| Molecular Formula | C22H23FN6O2 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 2-N-[4-(3-fluoropiperidin-1-yl)phenyl]-3-nitro-6-N-(pyridin-3-ylmethyl)pyridine-2,6-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCc2cccnc2)nc1Nc1ccc(N2CCCC(F)C2)cc1 |
| InChI | InChI=1S/C22H23FN6O2/c23-17-4-2-12-28(15-17)19-7-5-18(6-8-19)26-22-20(29(30)31)9-10-21(27-22)25-14-16-3-1-11-24-13-16/h1,3,5-11,13,17H,2,4,12,14-15H2,(H2,25,26,27) |
| InChIKey | DKIYBRJTZKSSCW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|