C22H29F2N5O3S — CID 140572786
N-[difluoro-[1-[4-(1-methylimidazol-4-yl)sulfonylpiperazin-1-yl]cyclohexyl]methyl]benzamide (PubChem CID 140572786) has the molecular formula C22H29F2N5O3S and a molecular weight of 481.57 g/mol. Its IUPAC name is N-[difluoro-[1-[4-(1-methylimidazol-4-yl)sulfonylpiperazin-1-yl]cyclohexyl]methyl]benzamide.
| Compound Name | N-[difluoro-[1-[4-(1-methylimidazol-4-yl)sulfonylpiperazin-1-yl]cyclohexyl]methyl]benzamide |
|---|---|
| PubChem CID | 140572786 |
| Molecular Formula | C22H29F2N5O3S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | N-[difluoro-[1-[4-(1-methylimidazol-4-yl)sulfonylpiperazin-1-yl]cyclohexyl]methyl]benzamide |
| SMILES | Cn1cnc(S(=O)(=O)N2CCN(C3(C(F)(F)NC(=O)c4ccccc4)CCCCC3)CC2)c1 |
| InChI | InChI=1S/C22H29F2N5O3S/c1-27-16-19(25-17-27)33(31,32)29-14-12-28(13-15-29)21(10-6-3-7-11-21)22(23,24)26-20(30)18-8-4-2-5-9-18/h2,4-5,8-9,16-17H,3,6-7,10-15H2,1H3,(H,26,30) |
| InChIKey | AEPZONQDAVDKRG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|