C17H31ClF4N6O — CID 140573822
2-N-(2-chloropiperidin-4-yl)-4-N-[(4-fluorocyclohexyl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazinane-2,4-diamine (PubChem CID 140573822) has the molecular formula C17H31ClF4N6O and a molecular weight of 446.92 g/mol. Its IUPAC name is 2-N-(2-chloropiperidin-4-yl)-4-N-[(4-fluorocyclohexyl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazinane-2,4-diamine.
| Compound Name | 2-N-(2-chloropiperidin-4-yl)-4-N-[(4-fluorocyclohexyl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazinane-2,4-diamine |
|---|---|
| PubChem CID | 140573822 |
| Molecular Formula | C17H31ClF4N6O |
| Molecular Weight | 446.92 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 2-N-(2-chloropiperidin-4-yl)-4-N-[(4-fluorocyclohexyl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazinane-2,4-diamine |
| SMILES | FC1CCC(CNC2NC(NC3CCNC(Cl)C3)NC(OCC(F)(F)F)N2)CC1 |
| InChI | InChI=1S/C17H31ClF4N6O/c18-13-7-12(5-6-23-13)25-15-26-14(24-8-10-1-3-11(19)4-2-10)27-16(28-15)29-9-17(20,21)22/h10-16,23-28H,1-9H2 |
| InChIKey | FMDODRZLXWWMSN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.92 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|