About CID 140573844
CID 140573844 (PubChem CID 140573844) has the molecular formula C28H47F6N7O4S
and a molecular weight of 691.78 g/mol.
Molecular Properties
| Compound Name | CID 140573844 |
| PubChem CID | 140573844 |
| Molecular Formula | C28H47F6N7O4S |
| Molecular Weight | 691.78 g/mol |
| Exact Mass | 691.33 |
| IUPAC Name | — |
| SMILES | CCC(=O)N1CCC2CC([S+](=O)([O-])N3CCC(NC4NC(NC5CCCC(C(F)(F)F)C5)NC(OCC(F)(F)F)N4)CC3)CCC21 |
| InChI | InChI=1S/C28H47F6N7O4S/c1-2-23(42)41-13-8-17-14-21(6-7-22(17)41)46(43,44)40-11-9-19(10-12-40)35-24-37-25(39-26(38-24)45-16-27(29,30)31)36-20-5-3-4-18(15-20)28(32,33)34/h17-22,24-26,35-39H,2-16H2,1H3 |
| InChIKey | TVTNPAULQUPYHS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 133.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 691.78 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 140573844 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140573844?
The IUPAC name of CID 140573844 (CID 140573844) is not available.
What is the SMILES notation for CID 140573844?
The canonical SMILES for CID 140573844 is CCC(=O)N1CCC2CC([S+](=O)([O-])N3CCC(NC4NC(NC5CCCC(C(F)(F)F)C5)NC(OCC(F)(F)F)N4)CC3)CCC21.
What is the InChIKey of CID 140573844?
The InChIKey is TVTNPAULQUPYHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H47F6N7O4S/c1-2-23(42)41-13-8-17-14-21(6-7-22(17)41)46(43,44)40-11-9-19(10-12-40)35-24-37-25(39-26(38-24)45-16-27(29,30)31)36-20-5-3-4-18(15-20)28(32,33)34/h17-22,24-26,35-39H,2-16H2,1H3.
What are the key properties of CID 140573844?
CID 140573844 has a molecular weight of 691.78 g/mol, XLogP of 2.69, 9 rotatable bonds, 5 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140573844 is sourced from PubChem (CID 140573844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).