C11H15F2N3O — CID 140574616
N-(4,4-difluorocyclohexyl)-2H-pyrimidine-1-carboxamide (PubChem CID 140574616) has the molecular formula C11H15F2N3O and a molecular weight of 243.26 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-2H-pyrimidine-1-carboxamide.
| Compound Name | N-(4,4-difluorocyclohexyl)-2H-pyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 140574616 |
| Molecular Formula | C11H15F2N3O |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-2H-pyrimidine-1-carboxamide |
| SMILES | O=C(NC1CCC(F)(F)CC1)N1C=CC=NC1 |
| InChI | InChI=1S/C11H15F2N3O/c12-11(13)4-2-9(3-5-11)15-10(17)16-7-1-6-14-8-16/h1,6-7,9H,2-5,8H2,(H,15,17) |
| InChIKey | NLDZRBGLZCQTIA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |