About 2-hydroxy-2-(4-hydroxypentyl)-1,3-dioxonane-4,9-dione
2-hydroxy-2-(4-hydroxypentyl)-1,3-dioxonane-4,9-dione (PubChem CID 140574837) has the molecular formula C12H20O6
and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-hydroxy-2-(4-hydroxypentyl)-1,3-dioxonane-4,9-dione.
Molecular Properties
| Compound Name | 2-hydroxy-2-(4-hydroxypentyl)-1,3-dioxonane-4,9-dione |
| PubChem CID | 140574837 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-hydroxy-2-(4-hydroxypentyl)-1,3-dioxonane-4,9-dione |
| SMILES | CC(O)CCCC1(O)OC(=O)CCCCC(=O)O1 |
| InChI | InChI=1S/C12H20O6/c1-9(13)5-4-8-12(16)17-10(14)6-2-3-7-11(15)18-12/h9,13,16H,2-8H2,1H3 |
| InChIKey | ZFMMBZVFJLFDJZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-hydroxy-2-(4-hydroxypentyl)-1,3-dioxonane-4,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-(4-hydroxypentyl)-1,3-dioxonane-4,9-dione?
The IUPAC name of 2-hydroxy-2-(4-hydroxypentyl)-1,3-dioxonane-4,9-dione (CID 140574837) is 2-hydroxy-2-(4-hydroxypentyl)-1,3-dioxonane-4,9-dione.
What is the SMILES notation for 2-hydroxy-2-(4-hydroxypentyl)-1,3-dioxonane-4,9-dione?
The canonical SMILES for 2-hydroxy-2-(4-hydroxypentyl)-1,3-dioxonane-4,9-dione is CC(O)CCCC1(O)OC(=O)CCCCC(=O)O1.
What is the InChIKey of 2-hydroxy-2-(4-hydroxypentyl)-1,3-dioxonane-4,9-dione?
The InChIKey is ZFMMBZVFJLFDJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O6/c1-9(13)5-4-8-12(16)17-10(14)6-2-3-7-11(15)18-12/h9,13,16H,2-8H2,1H3.
What are the key properties of 2-hydroxy-2-(4-hydroxypentyl)-1,3-dioxonane-4,9-dione?
2-hydroxy-2-(4-hydroxypentyl)-1,3-dioxonane-4,9-dione has a molecular weight of 260.29 g/mol, XLogP of 0.84, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(4-hydroxypentyl)-1,3-dioxonane-4,9-dione is sourced from PubChem (CID 140574837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).