C20H22O16 — CID 140574875
1',6,6'-trihydroxy-1-(3-hydroxypentyl)-2,2'-spirobi[3,9,10-trioxabicyclo[4.3.2]undecane]-4,4',8,8',11,11'-hexone (PubChem CID 140574875) has the molecular formula C20H22O16 and a molecular weight of 518.38 g/mol. Its IUPAC name is 1',6,6'-trihydroxy-1-(3-hydroxypentyl)-2,2'-spirobi[3,9,10-trioxabicyclo[4.3.2]undecane]-4,4',8,8',11,11'-hexone.
| Compound Name | 1',6,6'-trihydroxy-1-(3-hydroxypentyl)-2,2'-spirobi[3,9,10-trioxabicyclo[4.3.2]undecane]-4,4',8,8',11,11'-hexone |
|---|---|
| PubChem CID | 140574875 |
| Molecular Formula | C20H22O16 |
| Molecular Weight | 518.38 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | 1',6,6'-trihydroxy-1-(3-hydroxypentyl)-2,2'-spirobi[3,9,10-trioxabicyclo[4.3.2]undecane]-4,4',8,8',11,11'-hexone |
| SMILES | CCC(O)CCC12OC(=O)CC(O)(CC(=O)OC13OC(=O)CC1(O)CC(=O)OC3(O)OC1=O)C(=O)O2 |
| InChI | InChI=1S/C20H22O16/c1-2-9(21)3-4-18-19(32-11(23)6-16(28,14(26)35-18)5-10(22)31-18)20(30)34-13(25)8-17(29,15(27)36-20)7-12(24)33-19/h9,21,28-30H,2-8H2,1H3 |
| InChIKey | HUJSXFBISVLVNX-UHFFFAOYSA-N |
| XLogP | -3.09 |
| TPSA | 238.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.38 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|