C14H21F3O9S — CID 14057500
methyl (2R)-2-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethylsulfonyloxy)acetate (PubChem CID 14057500) has the molecular formula C14H21F3O9S and a molecular weight of 422.37 g/mol. Its IUPAC name is methyl (2R)-2-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethylsulfonyloxy)acetate.
| Compound Name | methyl (2R)-2-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethylsulfonyloxy)acetate |
|---|---|
| PubChem CID | 14057500 |
| Molecular Formula | C14H21F3O9S |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | methyl (2R)-2-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethylsulfonyloxy)acetate |
| SMILES | COC(=O)[C@H](OS(=O)(=O)C(F)(F)F)[C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C14H21F3O9S/c1-12(2)22-6-7(23-12)8-9(25-13(3,4)24-8)10(11(18)21-5)26-27(19,20)14(15,16)17/h7-10H,6H2,1-5H3/t7-,8-,9+,10-/m1/s1 |
| InChIKey | TYDPWDADMOHMEO-DOLQZWNJSA-N |
| XLogP | 1.07 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|