C9H16FNO2S — CID 140575140
7-fluoro-5-methylsulfonyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole (PubChem CID 140575140) has the molecular formula C9H16FNO2S and a molecular weight of 221.30 g/mol. Its IUPAC name is 7-fluoro-5-methylsulfonyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole.
| Compound Name | 7-fluoro-5-methylsulfonyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
|---|---|
| PubChem CID | 140575140 |
| Molecular Formula | C9H16FNO2S |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 7-fluoro-5-methylsulfonyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
| SMILES | CS(=O)(=O)C1CC(F)C2NCCC2C1 |
| InChI | InChI=1S/C9H16FNO2S/c1-14(12,13)7-4-6-2-3-11-9(6)8(10)5-7/h6-9,11H,2-5H2,1H3 |
| InChIKey | FHYQWWPRFTVCJZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |