About tricyclohexyl-(2,5-dihydroxycyclohexyl)phosphanium
tricyclohexyl-(2,5-dihydroxycyclohexyl)phosphanium (PubChem CID 140575201) has the molecular formula C24H44O2P+
and a molecular weight of 395.59 g/mol. Its IUPAC name is tricyclohexyl-(2,5-dihydroxycyclohexyl)phosphanium.
Molecular Properties
| Compound Name | tricyclohexyl-(2,5-dihydroxycyclohexyl)phosphanium |
| PubChem CID | 140575201 |
| Molecular Formula | C24H44O2P+ |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.31 |
| IUPAC Name | tricyclohexyl-(2,5-dihydroxycyclohexyl)phosphanium |
| SMILES | OC1CCC(O)C([P+](C2CCCCC2)(C2CCCCC2)C2CCCCC2)C1 |
| InChI | InChI=1S/C24H44O2P/c25-19-16-17-23(26)24(18-19)27(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h19-26H,1-18H2/q+1 |
| InChIKey | UEUZLUHCWNXYDF-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tricyclohexyl-(2,5-dihydroxycyclohexyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclohexyl-(2,5-dihydroxycyclohexyl)phosphanium?
The IUPAC name of tricyclohexyl-(2,5-dihydroxycyclohexyl)phosphanium (CID 140575201) is tricyclohexyl-(2,5-dihydroxycyclohexyl)phosphanium.
What is the SMILES notation for tricyclohexyl-(2,5-dihydroxycyclohexyl)phosphanium?
The canonical SMILES for tricyclohexyl-(2,5-dihydroxycyclohexyl)phosphanium is OC1CCC(O)C([P+](C2CCCCC2)(C2CCCCC2)C2CCCCC2)C1.
What is the InChIKey of tricyclohexyl-(2,5-dihydroxycyclohexyl)phosphanium?
The InChIKey is UEUZLUHCWNXYDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44O2P/c25-19-16-17-23(26)24(18-19)27(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h19-26H,1-18H2/q+1.
What are the key properties of tricyclohexyl-(2,5-dihydroxycyclohexyl)phosphanium?
tricyclohexyl-(2,5-dihydroxycyclohexyl)phosphanium has a molecular weight of 395.59 g/mol, XLogP of 6.28, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclohexyl-(2,5-dihydroxycyclohexyl)phosphanium is sourced from PubChem (CID 140575201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).