About ethyl (2S,6R)-2,6-bis(2-cyclohexylethyl)-4-oxooxane-3-carboxylate
ethyl (2S,6R)-2,6-bis(2-cyclohexylethyl)-4-oxooxane-3-carboxylate (PubChem CID 140575672) has the molecular formula C24H40O4
and a molecular weight of 392.58 g/mol. Its IUPAC name is ethyl (2S,6R)-2,6-bis(2-cyclohexylethyl)-4-oxooxane-3-carboxylate.
Molecular Properties
| Compound Name | ethyl (2S,6R)-2,6-bis(2-cyclohexylethyl)-4-oxooxane-3-carboxylate |
| PubChem CID | 140575672 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | ethyl (2S,6R)-2,6-bis(2-cyclohexylethyl)-4-oxooxane-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C[C@@H](CCC2CCCCC2)O[C@H]1CCC1CCCCC1 |
| InChI | InChI=1S/C24H40O4/c1-2-27-24(26)23-21(25)17-20(15-13-18-9-5-3-6-10-18)28-22(23)16-14-19-11-7-4-8-12-19/h18-20,22-23H,2-17H2,1H3/t20-,22+,23?/m1/s1 |
| InChIKey | MSHXOASGFGBGKU-PTCKQWLISA-N |
| XLogP | 5.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2S,6R)-2,6-bis(2-cyclohexylethyl)-4-oxooxane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S,6R)-2,6-bis(2-cyclohexylethyl)-4-oxooxane-3-carboxylate?
The IUPAC name of ethyl (2S,6R)-2,6-bis(2-cyclohexylethyl)-4-oxooxane-3-carboxylate (CID 140575672) is ethyl (2S,6R)-2,6-bis(2-cyclohexylethyl)-4-oxooxane-3-carboxylate.
What is the SMILES notation for ethyl (2S,6R)-2,6-bis(2-cyclohexylethyl)-4-oxooxane-3-carboxylate?
The canonical SMILES for ethyl (2S,6R)-2,6-bis(2-cyclohexylethyl)-4-oxooxane-3-carboxylate is CCOC(=O)C1C(=O)C[C@@H](CCC2CCCCC2)O[C@H]1CCC1CCCCC1.
What is the InChIKey of ethyl (2S,6R)-2,6-bis(2-cyclohexylethyl)-4-oxooxane-3-carboxylate?
The InChIKey is MSHXOASGFGBGKU-PTCKQWLISA-N. The full InChI is InChI=1S/C24H40O4/c1-2-27-24(26)23-21(25)17-20(15-13-18-9-5-3-6-10-18)28-22(23)16-14-19-11-7-4-8-12-19/h18-20,22-23H,2-17H2,1H3/t20-,22+,23?/m1/s1.
What are the key properties of ethyl (2S,6R)-2,6-bis(2-cyclohexylethyl)-4-oxooxane-3-carboxylate?
ethyl (2S,6R)-2,6-bis(2-cyclohexylethyl)-4-oxooxane-3-carboxylate has a molecular weight of 392.58 g/mol, XLogP of 5.61, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S,6R)-2,6-bis(2-cyclohexylethyl)-4-oxooxane-3-carboxylate is sourced from PubChem (CID 140575672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).