About oct-7-ene-1,6-diimine
oct-7-ene-1,6-diimine (PubChem CID 140575832) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is oct-7-ene-1,6-diimine.
Molecular Properties
| Compound Name | oct-7-ene-1,6-diimine |
| PubChem CID | 140575832 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | oct-7-ene-1,6-diimine |
| SMILES | [H]/N=C(\C=C)CCCC/C=N/[H] |
| InChI | InChI=1S/C8H14N2/c1-2-8(10)6-4-3-5-7-9/h2,7,9-10H,1,3-6H2/b9-7+,10-8+ |
| InChIKey | QROKZUCNCUCGTD-FIFLTTCUSA-N |
| XLogP | 2.40 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze oct-7-ene-1,6-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-7-ene-1,6-diimine?
The IUPAC name of oct-7-ene-1,6-diimine (CID 140575832) is oct-7-ene-1,6-diimine.
What is the SMILES notation for oct-7-ene-1,6-diimine?
The canonical SMILES for oct-7-ene-1,6-diimine is [H]/N=C(\C=C)CCCC/C=N/[H].
What is the InChIKey of oct-7-ene-1,6-diimine?
The InChIKey is QROKZUCNCUCGTD-FIFLTTCUSA-N. The full InChI is InChI=1S/C8H14N2/c1-2-8(10)6-4-3-5-7-9/h2,7,9-10H,1,3-6H2/b9-7+,10-8+.
What are the key properties of oct-7-ene-1,6-diimine?
oct-7-ene-1,6-diimine has a molecular weight of 138.21 g/mol, XLogP of 2.40, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oct-7-ene-1,6-diimine is sourced from PubChem (CID 140575832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).