C33H46F5NO2S — CID 140576175
[(5S)-4-(cyclopenten-1-yl)-7,7-dimethyl-2-propan-2-yl-5-(2,3,3-trimethylbutan-2-yloxy)-6,8-dihydro-5H-quinolin-3-yl]-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanol (PubChem CID 140576175) has the molecular formula C33H46F5NO2S and a molecular weight of 615.79 g/mol. Its IUPAC name is [(5S)-4-(cyclopenten-1-yl)-7,7-dimethyl-2-propan-2-yl-5-(2,3,3-trimethylbutan-2-yloxy)-6,8-dihydro-5H-quinolin-3-yl]-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanol.
| Compound Name | [(5S)-4-(cyclopenten-1-yl)-7,7-dimethyl-2-propan-2-yl-5-(2,3,3-trimethylbutan-2-yloxy)-6,8-dihydro-5H-quinolin-3-yl]-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanol |
|---|---|
| PubChem CID | 140576175 |
| Molecular Formula | C33H46F5NO2S |
| Molecular Weight | 615.79 g/mol |
| Exact Mass | 615.32 |
| IUPAC Name | [(5S)-4-(cyclopenten-1-yl)-7,7-dimethyl-2-propan-2-yl-5-(2,3,3-trimethylbutan-2-yloxy)-6,8-dihydro-5H-quinolin-3-yl]-[4-(pentafluoro-λ6-sulfanyl)phenyl]methanol |
| SMILES | CC(C)c1nc2c(c(C3=CCCC3)c1C(O)c1ccc(S(F)(F)(F)(F)F)cc1)[C@@H](OC(C)(C)C(C)(C)C)CC(C)(C)C2 |
| InChI | InChI=1S/C33H46F5NO2S/c1-20(2)29-28(30(40)22-14-16-23(17-15-22)42(34,35,36,37)38)26(21-12-10-11-13-21)27-24(39-29)18-32(6,7)19-25(27)41-33(8,9)31(3,4)5/h12,14-17,20,25,30,40H,10-11,13,18-19H2,1-9H3/t25-,30?/m0/s1 |
| InChIKey | QQCZIHOSXHVRBW-SUHMBNCMSA-N |
| XLogP | 11.37 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.79 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |