About CID 140576512
CID 140576512 (PubChem CID 140576512) has the molecular formula C6H9N4
and a molecular weight of 137.17 g/mol.
Molecular Properties
| Compound Name | CID 140576512 |
| PubChem CID | 140576512 |
| Molecular Formula | C6H9N4 |
| Molecular Weight | 137.17 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | — |
| SMILES | [CH2]c1nc2n(n1)CCCN2 |
| InChI | InChI=1S/C6H9N4/c1-5-8-6-7-3-2-4-10(6)9-5/h1-4H2,(H,7,8,9) |
| InChIKey | HLTMVOLNPDORLA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.17 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 140576512 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140576512?
The IUPAC name of CID 140576512 (CID 140576512) is not available.
What is the SMILES notation for CID 140576512?
The canonical SMILES for CID 140576512 is [CH2]c1nc2n(n1)CCCN2.
What is the InChIKey of CID 140576512?
The InChIKey is HLTMVOLNPDORLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N4/c1-5-8-6-7-3-2-4-10(6)9-5/h1-4H2,(H,7,8,9).
What are the key properties of CID 140576512?
CID 140576512 has a molecular weight of 137.17 g/mol, XLogP of 0.28, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140576512 is sourced from PubChem (CID 140576512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).