C48H68 — CID 140577060
2,7-ditert-butyl-9-[2-(2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-en-2-yl]-4b,8a,9,9a-tetrahydro-4aH-fluorene (PubChem CID 140577060) has the molecular formula C48H68 and a molecular weight of 645.07 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-[2-(2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-en-2-yl]-4b,8a,9,9a-tetrahydro-4aH-fluorene.
| Compound Name | 2,7-ditert-butyl-9-[2-(2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-en-2-yl]-4b,8a,9,9a-tetrahydro-4aH-fluorene |
|---|---|
| PubChem CID | 140577060 |
| Molecular Formula | C48H68 |
| Molecular Weight | 645.07 g/mol |
| Exact Mass | 644.53 |
| IUPAC Name | 2,7-ditert-butyl-9-[2-(2,7-ditert-butyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)hex-5-en-2-yl]-4b,8a,9,9a-tetrahydro-4aH-fluorene |
| SMILES | C=CCCC(C)(C1C2C=C(C(C)(C)C)C=CC2C2C=CC(C(C)(C)C)=CC21)C1C2C=C(C(C)(C)C)C=CC2C2C=CC(C(C)(C)C)=CC21 |
| InChI | InChI=1S/C48H68/c1-15-16-25-48(14,42-38-26-30(44(2,3)4)17-21-34(38)35-22-18-31(27-39(35)42)45(5,6)7)43-40-28-32(46(8,9)10)19-23-36(40)37-24-20-33(29-41(37)43)47(11,12)13/h15,17-24,26-29,34-43H,1,16,25H2,2-14H3 |
| InChIKey | NCMPCKQEYBJAKX-UHFFFAOYSA-N |
| XLogP | 13.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.07 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|