C20H18BrNO6 — CID 140577221
11b-[(4-bromophenyl)methyl]-9,11-dimethoxy-6,7-dihydro-[1,4,2]dioxazino[3,2-a]isoquinoline-2,3-dione (PubChem CID 140577221) has the molecular formula C20H18BrNO6 and a molecular weight of 448.27 g/mol. Its IUPAC name is 11b-[(4-bromophenyl)methyl]-9,11-dimethoxy-6,7-dihydro-[1,4,2]dioxazino[3,2-a]isoquinoline-2,3-dione.
| Compound Name | 11b-[(4-bromophenyl)methyl]-9,11-dimethoxy-6,7-dihydro-[1,4,2]dioxazino[3,2-a]isoquinoline-2,3-dione |
|---|---|
| PubChem CID | 140577221 |
| Molecular Formula | C20H18BrNO6 |
| Molecular Weight | 448.27 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 11b-[(4-bromophenyl)methyl]-9,11-dimethoxy-6,7-dihydro-[1,4,2]dioxazino[3,2-a]isoquinoline-2,3-dione |
| SMILES | COc1cc2c(c(OC)c1)C1(Cc3ccc(Br)cc3)OC(=O)C(=O)ON1CC2 |
| InChI | InChI=1S/C20H18BrNO6/c1-25-15-9-13-7-8-22-20(17(13)16(10-15)26-2,27-18(23)19(24)28-22)11-12-3-5-14(21)6-4-12/h3-6,9-10H,7-8,11H2,1-2H3 |
| InChIKey | LZKZMAKLQQZXMK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|