About N,N'-bis(1-adamantyl)-N,N'-diphenylmethanediamine;chlorogold
N,N'-bis(1-adamantyl)-N,N'-diphenylmethanediamine;chlorogold (PubChem CID 140577348) has the molecular formula C33H41AuClN2-
and a molecular weight of 698.13 g/mol. Its IUPAC name is N,N'-bis(1-adamantyl)-N,N'-diphenylmethanediamine;chlorogold.
Molecular Properties
| Compound Name | N,N'-bis(1-adamantyl)-N,N'-diphenylmethanediamine;chlorogold |
| PubChem CID | 140577348 |
| Molecular Formula | C33H41AuClN2- |
| Molecular Weight | 698.13 g/mol |
| Exact Mass | 697.26 |
| IUPAC Name | N,N'-bis(1-adamantyl)-N,N'-diphenylmethanediamine;chlorogold |
| SMILES | Cl[Au].c1ccc(N([CH-]N(c2ccccc2)C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C33H41N2.Au.ClH/c1-3-7-30(8-4-1)34(32-17-24-11-25(18-32)13-26(12-24)19-32)23-35(31-9-5-2-6-10-31)33-20-27-14-28(21-33)16-29(15-27)22-33;;/h1-10,23-29H,11-22H2;;1H/q-1;+1;/p-1 |
| InChIKey | XPTOONKVDMPVDP-UHFFFAOYSA-M |
| XLogP | 8.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 698.13 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(1-adamantyl)-N,N'-diphenylmethanediamine;chlorogold with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(1-adamantyl)-N,N'-diphenylmethanediamine;chlorogold?
The IUPAC name of N,N'-bis(1-adamantyl)-N,N'-diphenylmethanediamine;chlorogold (CID 140577348) is N,N'-bis(1-adamantyl)-N,N'-diphenylmethanediamine;chlorogold.
What is the SMILES notation for N,N'-bis(1-adamantyl)-N,N'-diphenylmethanediamine;chlorogold?
The canonical SMILES for N,N'-bis(1-adamantyl)-N,N'-diphenylmethanediamine;chlorogold is Cl[Au].c1ccc(N([CH-]N(c2ccccc2)C23CC4CC(CC(C4)C2)C3)C23CC4CC(CC(C4)C2)C3)cc1.
What is the InChIKey of N,N'-bis(1-adamantyl)-N,N'-diphenylmethanediamine;chlorogold?
The InChIKey is XPTOONKVDMPVDP-UHFFFAOYSA-M. The full InChI is InChI=1S/C33H41N2.Au.ClH/c1-3-7-30(8-4-1)34(32-17-24-11-25(18-32)13-26(12-24)19-32)23-35(31-9-5-2-6-10-31)33-20-27-14-28(21-33)16-29(15-27)22-33;;/h1-10,23-29H,11-22H2;;1H/q-1;+1;/p-1.
What are the key properties of N,N'-bis(1-adamantyl)-N,N'-diphenylmethanediamine;chlorogold?
N,N'-bis(1-adamantyl)-N,N'-diphenylmethanediamine;chlorogold has a molecular weight of 698.13 g/mol, XLogP of 8.74, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(1-adamantyl)-N,N'-diphenylmethanediamine;chlorogold is sourced from PubChem (CID 140577348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).