About methylidenezirconium(2+);bis(1-(2-propyl-1H-inden-1-id-4-yl)naphthalene)
methylidenezirconium(2+);bis(1-(2-propyl-1H-inden-1-id-4-yl)naphthalene) (PubChem CID 140577424) has the molecular formula C45H40Zr
and a molecular weight of 672.04 g/mol. Its IUPAC name is methylidenezirconium(2+);bis(1-(2-propyl-1H-inden-1-id-4-yl)naphthalene).
Molecular Properties
| Compound Name | methylidenezirconium(2+);bis(1-(2-propyl-1H-inden-1-id-4-yl)naphthalene) |
| PubChem CID | 140577424 |
| Molecular Formula | C45H40Zr |
| Molecular Weight | 672.04 g/mol |
| Exact Mass | 670.22 |
| IUPAC Name | methylidenezirconium(2+);bis(1-(2-propyl-1H-inden-1-id-4-yl)naphthalene) |
| SMILES | C=[Zr+2].CCCc1cc2c(-c3cccc4ccccc34)cccc2[cH-]1.CCCc1cc2c(-c3cccc4ccccc34)cccc2[cH-]1 |
| InChI | InChI=1S/2C22H19.CH2.Zr/c2*1-2-7-16-14-18-10-6-13-21(22(18)15-16)20-12-5-9-17-8-3-4-11-19(17)20;;/h2*3-6,8-15H,2,7H2,1H3;1H2;/q2*-1;;+2 |
| InChIKey | UOIOUFZRZYDIMU-UHFFFAOYSA-N |
| XLogP | 12.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 672.04 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methylidenezirconium(2+);bis(1-(2-propyl-1H-inden-1-id-4-yl)naphthalene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylidenezirconium(2+);bis(1-(2-propyl-1H-inden-1-id-4-yl)naphthalene)?
The IUPAC name of methylidenezirconium(2+);bis(1-(2-propyl-1H-inden-1-id-4-yl)naphthalene) (CID 140577424) is methylidenezirconium(2+);bis(1-(2-propyl-1H-inden-1-id-4-yl)naphthalene).
What is the SMILES notation for methylidenezirconium(2+);bis(1-(2-propyl-1H-inden-1-id-4-yl)naphthalene)?
The canonical SMILES for methylidenezirconium(2+);bis(1-(2-propyl-1H-inden-1-id-4-yl)naphthalene) is C=[Zr+2].CCCc1cc2c(-c3cccc4ccccc34)cccc2[cH-]1.CCCc1cc2c(-c3cccc4ccccc34)cccc2[cH-]1.
What is the InChIKey of methylidenezirconium(2+);bis(1-(2-propyl-1H-inden-1-id-4-yl)naphthalene)?
The InChIKey is UOIOUFZRZYDIMU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C22H19.CH2.Zr/c2*1-2-7-16-14-18-10-6-13-21(22(18)15-16)20-12-5-9-17-8-3-4-11-19(17)20;;/h2*3-6,8-15H,2,7H2,1H3;1H2;/q2*-1;;+2.
What are the key properties of methylidenezirconium(2+);bis(1-(2-propyl-1H-inden-1-id-4-yl)naphthalene)?
methylidenezirconium(2+);bis(1-(2-propyl-1H-inden-1-id-4-yl)naphthalene) has a molecular weight of 672.04 g/mol, XLogP of 12.63, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methylidenezirconium(2+);bis(1-(2-propyl-1H-inden-1-id-4-yl)naphthalene) is sourced from PubChem (CID 140577424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).