C12H16NO+ — CID 140577603
7,9-dimethyl-1,2,3,4-tetrahydro-1-benzazepin-1-ium-5-one (PubChem CID 140577603) has the molecular formula C12H16NO+ and a molecular weight of 190.27 g/mol. Its IUPAC name is 7,9-dimethyl-1,2,3,4-tetrahydro-1-benzazepin-1-ium-5-one.
| Compound Name | 7,9-dimethyl-1,2,3,4-tetrahydro-1-benzazepin-1-ium-5-one |
|---|---|
| PubChem CID | 140577603 |
| Molecular Formula | C12H16NO+ |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 7,9-dimethyl-1,2,3,4-tetrahydro-1-benzazepin-1-ium-5-one |
| SMILES | Cc1cc(C)c2c(c1)C(=O)CCC[NH2+]2 |
| InChI | InChI=1S/C12H15NO/c1-8-6-9(2)12-10(7-8)11(14)4-3-5-13-12/h6-7,13H,3-5H2,1-2H3/p+1 |
| InChIKey | NHRMNGWYLGVOOQ-UHFFFAOYSA-O |
| XLogP | 1.47 |
| TPSA | 33.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|