C23H25N2O2S- — CID 140577623
2-[11-methyl-13-(4-methylphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl]pentanoate (PubChem CID 140577623) has the molecular formula C23H25N2O2S- and a molecular weight of 393.53 g/mol. Its IUPAC name is 2-[11-methyl-13-(4-methylphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl]pentanoate.
| Compound Name | 2-[11-methyl-13-(4-methylphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl]pentanoate |
|---|---|
| PubChem CID | 140577623 |
| Molecular Formula | C23H25N2O2S- |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-[11-methyl-13-(4-methylphenyl)-8-thia-5,10-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraen-12-yl]pentanoate |
| SMILES | CCCC(C(=O)[O-])c1c(C)nc2sc3c(c2c1-c1ccc(C)cc1)CCNC3 |
| InChI | InChI=1S/C23H26N2O2S/c1-4-5-17(23(26)27)19-14(3)25-22-21(16-10-11-24-12-18(16)28-22)20(19)15-8-6-13(2)7-9-15/h6-9,17,24H,4-5,10-12H2,1-3H3,(H,26,27)/p-1 |
| InChIKey | XTJSEZCPIHQQFC-UHFFFAOYSA-M |
| XLogP | 3.86 |
| TPSA | 65.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |